
CAS 1262011-13-1
:2-[4-Methoxy-3-(trifluoromethyl)phenyl]-4-pyridinol
Description:
2-[4-Methoxy-3-(trifluoromethyl)phenyl]-4-pyridinol, identified by its CAS number 1262011-13-1, is an organic compound characterized by its complex structure, which includes a pyridine ring and a phenyl group substituted with both a methoxy and a trifluoromethyl group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential biological activity, making it of interest in pharmaceutical research. The presence of the trifluoromethyl group often enhances lipophilicity and metabolic stability, while the methoxy group can influence the compound's electronic properties and reactivity. Additionally, the pyridinol moiety may contribute to its potential as a ligand in coordination chemistry or as a precursor in synthetic pathways. Overall, the unique combination of functional groups in this compound suggests it may have applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific properties such as melting point, boiling point, and spectral data would require experimental determination or literature reference for precise characterization.
Formula:C13H10F3NO2
InChI:InChI=1S/C13H10F3NO2/c1-19-12-3-2-8(6-10(12)13(14,15)16)11-7-9(18)4-5-17-11/h2-7H,1H3,(H,17,18)
InChI key:InChIKey=RUWFONZLTKZUKD-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C(C=CC1OC)C2=CC(O)=CC=N2
Synonyms:- 4-Pyridinol, 2-[4-methoxy-3-(trifluoromethyl)phenyl]-
- 2-[4-Methoxy-3-(trifluoromethyl)phenyl]-4-pyridinol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.