
CAS 1262011-32-4
:2-(2-Hydroxyphenyl)-4-pyridinol
Description:
2-(2-Hydroxyphenyl)-4-pyridinol, identified by its CAS number 1262011-32-4, is an organic compound characterized by its unique structural features, which include a pyridine ring and a phenolic hydroxyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. It is often studied for its role in medicinal chemistry, particularly for its potential as an antimicrobial or anti-inflammatory agent. The presence of the hydroxyl group enhances its solubility in polar solvents and may influence its reactivity and interaction with biological targets. Additionally, the compound's molecular structure allows for various substitution patterns, which can affect its pharmacological properties. As with many organic compounds, its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 2-(2-Hydroxyphenyl)-4-pyridinol represents a class of compounds that are of interest in both synthetic and medicinal chemistry due to their diverse applications and biological significance.
Formula:C11H9NO2
InChI:InChI=1S/C11H9NO2/c13-8-5-6-12-10(7-8)9-3-1-2-4-11(9)14/h1-7,14H,(H,12,13)
InChI key:InChIKey=IIJHKCCCUFWOQE-UHFFFAOYSA-N
SMILES:OC1=C(C2=CC(O)=CC=N2)C=CC=C1
Synonyms:- 2-(2-Hydroxyphenyl)-4-pyridinol
- 4-Pyridinol, 2-(2-hydroxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.