CAS 1262011-47-1

4-(5-Hydroxy-2-pyridinyl)-2-thiophenecarboxylic acid

Description:

4-(5-Hydroxy-2-pyridinyl)-2-thiophenecarboxylic acid, identified by its CAS number 1262011-47-1, is a chemical compound that features a pyridine ring substituted with a hydroxyl group and a thiophene ring with a carboxylic acid functional group. This compound exhibits both acidic and aromatic characteristics due to the presence of the carboxylic acid and the heterocyclic rings. The hydroxyl group contributes to its potential as a hydrogen bond donor, enhancing its solubility in polar solvents. The thiophene moiety adds to its electronic properties, making it potentially useful in various applications, including pharmaceuticals and agrochemicals. The compound may also exhibit biological activity, which can be attributed to the structural features of the pyridine and thiophene rings. Overall, its unique structure suggests that it could be of interest in medicinal chemistry and materials science, although specific biological activities and applications would require further investigation.

Formula: C₁₀H₇NO₃S

InChI: InChI=1S/C10H7NO3S/c12-7-1-2-8(11-4-7)6-3-9(10(13)14)15-5-6/h1-5,12H,(H,13,14)

InChI key: InChIKey=IEZJMBSKVYBVST-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC(=CS1)C2=CC=C(O)C=N2

Synonyms:

• 2-Thiophenecarboxylic acid, 4-(5-hydroxy-2-pyridinyl)-
• 4-(5-Hydroxy-2-pyridinyl)-2-thiophenecarboxylic acid