
CAS 1262011-48-2
:2-(2-Chloro-5-hydroxyphenyl)-4-pyridinol
Description:
2-(2-Chloro-5-hydroxyphenyl)-4-pyridinol, identified by its CAS number 1262011-48-2, is a chemical compound characterized by its unique structural features, which include a pyridine ring and a chlorinated phenolic moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as potential solubility in organic solvents and moderate polarity. The presence of the hydroxyl group contributes to its ability to engage in hydrogen bonding, which can influence its reactivity and interaction with biological systems. Additionally, the chlorine substituent may impart specific electronic effects, affecting the compound's overall stability and reactivity. This compound may be of interest in various fields, including medicinal chemistry and agrochemicals, due to its potential biological activity. However, detailed studies would be necessary to fully elucidate its properties, including its pharmacokinetics, toxicity, and specific applications. As with any chemical substance, proper handling and safety protocols should be observed when working with this compound.
Formula:C11H8ClNO2
InChI:InChI=1S/C11H8ClNO2/c12-10-2-1-7(14)5-9(10)11-6-8(15)3-4-13-11/h1-6,14H,(H,13,15)
InChI key:InChIKey=PBRKTXUOCXMOOF-UHFFFAOYSA-N
SMILES:ClC1=C(C2=CC(O)=CC=N2)C=C(O)C=C1
Synonyms:- 4-Pyridinol, 2-(2-chloro-5-hydroxyphenyl)-
- 2-(2-Chloro-5-hydroxyphenyl)-4-pyridinol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.