
CAS 1262011-49-3
:2-(3-Chloro-4-fluorophenyl)-4-pyridinol
Description:
2-(3-Chloro-4-fluorophenyl)-4-pyridinol, identified by its CAS number 1262011-49-3, is a chemical compound characterized by its unique structural features, which include a pyridine ring and a substituted phenyl group. The presence of a chloro and a fluoro substituent on the phenyl ring contributes to its potential reactivity and biological activity. This compound typically exhibits properties such as moderate solubility in organic solvents and may show limited solubility in water, which is common for many aromatic compounds. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can engage in various chemical interactions. Additionally, the compound may exhibit specific biological activities, making it of interest for research in areas such as drug discovery or agrochemicals. Safety and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with its use.
Formula:C11H7ClFNO
InChI:InChI=1S/C11H7ClFNO/c12-9-5-7(1-2-10(9)13)11-6-8(15)3-4-14-11/h1-6H,(H,14,15)
InChI key:InChIKey=HHFXBMINFSGOHZ-UHFFFAOYSA-N
SMILES:ClC=1C=C(C=CC1F)C2=CC(O)=CC=N2
Synonyms:- 2-(3-Chloro-4-fluorophenyl)-4-pyridinol
- 4-Pyridinol, 2-(3-chloro-4-fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.