CymitQuimica logo

CAS 1262011-50-6

:

4-(3,4-Dichlorophenyl)-3-pyridinecarboxylic acid

Description:
4-(3,4-Dichlorophenyl)-3-pyridinecarboxylic acid, identified by its CAS number 1262011-50-6, is a chemical compound characterized by its aromatic and heterocyclic structure. It features a pyridine ring substituted with a carboxylic acid group and a dichlorophenyl moiety, which contributes to its potential biological activity. The presence of chlorine atoms enhances its lipophilicity and may influence its interaction with biological targets. This compound is typically solid at room temperature and may exhibit moderate solubility in organic solvents while being less soluble in water due to its hydrophobic characteristics. Its functional groups suggest potential applications in pharmaceuticals, particularly in the development of agrochemicals or medicinal compounds. The compound's reactivity can be attributed to the carboxylic acid group, which can participate in various chemical reactions, including esterification and amidation. Overall, 4-(3,4-Dichlorophenyl)-3-pyridinecarboxylic acid is of interest in both synthetic chemistry and medicinal chemistry due to its unique structural features and potential applications.
Formula:C12H7Cl2NO2
InChI:InChI=1S/C12H7Cl2NO2/c13-10-2-1-7(5-11(10)14)8-3-4-15-6-9(8)12(16)17/h1-6H,(H,16,17)
InChI key:InChIKey=SHZLJGLSWAEBNL-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(=CC=NC1)C2=CC(Cl)=C(Cl)C=C2
Synonyms:
  • 4-(3,4-Dichlorophenyl)-3-pyridinecarboxylic acid
  • 3-Pyridinecarboxylic acid, 4-(3,4-dichlorophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.