
CAS 1262011-51-7
:2-[4-(Methylsulfonyl)phenyl]-4-pyridinol
Description:
2-[4-(Methylsulfonyl)phenyl]-4-pyridinol, identified by its CAS number 1262011-51-7, is an organic compound characterized by its pyridine and phenyl functional groups. This compound features a pyridinol structure, which includes a hydroxyl group (-OH) attached to the pyridine ring, contributing to its potential as a weak acid. The presence of a methylsulfonyl group (-SO2CH3) on the phenyl ring enhances its solubility in polar solvents and may influence its biological activity. This compound is of interest in medicinal chemistry due to its potential pharmacological properties, which may include anti-inflammatory or antimicrobial effects. Its molecular structure suggests that it could participate in hydrogen bonding, affecting its reactivity and interactions with biological targets. Additionally, the presence of both aromatic and heterocyclic components may contribute to its stability and reactivity under various conditions. Overall, 2-[4-(Methylsulfonyl)phenyl]-4-pyridinol represents a versatile scaffold for further chemical modifications and investigations in drug development.
Formula:C12H11NO3S
InChI:InChI=1S/C12H11NO3S/c1-17(15,16)11-4-2-9(3-5-11)12-8-10(14)6-7-13-12/h2-8H,1H3,(H,13,14)
InChI key:InChIKey=KAQFXLILPXZHFX-UHFFFAOYSA-N
SMILES:OC=1C=C(N=CC1)C2=CC=C(S(C)(=O)=O)C=C2
Synonyms:- 4-Pyridinol, 2-[4-(methylsulfonyl)phenyl]-
- 2-[4-(Methylsulfonyl)phenyl]-4-pyridinol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.