CAS 1262019-07-7

3-(3-Bromo-5-chlorophenyl)-2-propenoic acid

Description:

3-(3-Bromo-5-chlorophenyl)-2-propenoic acid is an organic compound characterized by its unique structure, which includes a propenoic acid moiety and a substituted phenyl group. The presence of both bromine and chlorine atoms on the phenyl ring contributes to its reactivity and potential applications in various chemical reactions, including electrophilic aromatic substitution. This compound typically exhibits properties associated with unsaturated carboxylic acids, such as acidity due to the carboxyl functional group, and it may participate in polymerization reactions due to the double bond in the propenoic acid structure. The halogen substituents can influence the compound's solubility, stability, and biological activity, making it of interest in medicinal chemistry and materials science. Additionally, the compound's molecular interactions may be affected by the electron-withdrawing nature of the halogens, which can enhance its reactivity in certain synthetic pathways. Overall, 3-(3-Bromo-5-chlorophenyl)-2-propenoic acid represents a versatile building block in organic synthesis.

Formula: C₉H₆BrClO₂

InChI: InChI=1S/C9H6BrClO2/c10-7-3-6(1-2-9(12)13)4-8(11)5-7/h1-5H,(H,12,13)

InChI key: InChIKey=XURPZVOWFXSPGJ-UHFFFAOYSA-N

SMILES: C(=CC(O)=O)C1=CC(Br)=CC(Cl)=C1

Synonyms:

• 2-Propenoic acid, 3-(3-bromo-5-chlorophenyl)-
• 3-(3-Bromo-5-chlorophenyl)-2-propenoic acid