CymitQuimica logo

CAS 126202-92-4

:

2-Amino-6-(4-bromophenyl)-4-(4-methoxyphenyl)-3-pyridinecarbonitrile

Description:
2-Amino-6-(4-bromophenyl)-4-(4-methoxyphenyl)-3-pyridinecarbonitrile is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with various functional groups. The presence of an amino group and a cyano group indicates potential reactivity and the ability to participate in various chemical reactions, such as nucleophilic substitutions. The bromophenyl and methoxyphenyl substituents contribute to the compound's hydrophobic characteristics and may influence its biological activity, making it of interest in medicinal chemistry. This compound may exhibit specific solubility properties, depending on the solvent used, and its molecular interactions can be influenced by the presence of the bromine and methoxy groups. Additionally, the compound's structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. Overall, its unique combination of functional groups and structural features makes it a subject of interest for further research and development in various chemical and biological contexts.
Formula:C19H14BrN3O
InChI:InChI=1S/C19H14BrN3O/c1-24-15-8-4-12(5-9-15)16-10-18(23-19(22)17(16)11-21)13-2-6-14(20)7-3-13/h2-10H,1H3,(H2,22,23)
InChI key:InChIKey=BUVGDGZHVOBLSG-UHFFFAOYSA-N
SMILES:C(#N)C=1C(=CC(=NC1N)C2=CC=C(Br)C=C2)C3=CC=C(OC)C=C3
Synonyms:
  • 2-Amino-6-(4-bromophenyl)-4-(4-methoxyphenyl)-3-pyridinecarbonitrile
  • 3-Pyridinecarbonitrile, 2-amino-6-(4-bromophenyl)-4-(4-methoxyphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.