
CAS 1262023-42-6
:β-D-Glucopyranoside, 4-hydroxyphenyl, 2,6-bis[(2E)-3-(1-hydroxy-4-oxo-2,5-cyclohexadien-1-yl)-2-propenoate]
Description:
β-D-Glucopyranoside, 4-hydroxyphenyl, 2,6-bis[(2E)-3-(1-hydroxy-4-oxo-2,5-cyclohexadien-1-yl)-2-propenoate] is a complex organic compound characterized by its glycosidic structure, which includes a glucose moiety linked to a phenolic group. This compound features multiple functional groups, including hydroxyl and ester functionalities, which contribute to its reactivity and potential biological activity. The presence of the 4-hydroxyphenyl group suggests antioxidant properties, while the cyclohexadienone moiety may indicate potential for various chemical transformations. The compound's structure implies it may participate in hydrogen bonding and other intermolecular interactions, influencing its solubility and stability in different solvents. Additionally, its intricate arrangement of double bonds and functional groups may allow for diverse applications in pharmaceuticals, food chemistry, or as a biochemical probe. Overall, this compound exemplifies the complexity and versatility found in natural product chemistry, particularly in the realm of glycosides and phenolic compounds.
Formula:C30H28O13
InChI:InChI=1S/C30H28O13/c31-18-1-3-21(4-2-18)41-28-27(43-24(35)10-16-30(39)13-7-20(33)8-14-30)26(37)25(36)22(42-28)17-40-23(34)9-15-29(38)11-5-19(32)6-12-29/h1-16,22,25-28,31,36-39H,17H2/b15-9+,16-10+/t22-,25-,26+,27-,28-/m1/s1
InChI key:InChIKey=DKNCSDJNWFKXEC-GEQWPRKQSA-N
SMILES:O([C@H]1[C@H](OC(/C=C/C2(O)C=CC(=O)C=C2)=O)[C@@H](O)[C@H](O)[C@@H](COC(/C=C/C3(O)C=CC(=O)C=C3)=O)O1)C4=CC=C(O)C=C4
Synonyms:- Robustaside G
- β-D-Glucopyranoside, 4-hydroxyphenyl, 2,6-bis[(2E)-3-(1-hydroxy-4-oxo-2,5-cyclohexadien-1-yl)-2-propenoate]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Robustaside G
CAS:<p>Robustaside G is a natural product that can be used as a reference standard. The CAS number of Robustaside G is 1262023-42-6.</p>Formula:C30H28O13Color and Shape:SolidMolecular weight:596.541
