
CAS 126213-52-3
:Poly(3,4-methylenedioxythiophene)
Description:
Poly(3,4-methylenedioxythiophene), commonly referred to as PEDOT, is a conductive polymer known for its excellent electrical conductivity, stability, and transparency. It is derived from the polymerization of 3,4-methylenedioxythiophene (MDOT), a monomer that features a thiophene ring with methylenedioxy substituents, enhancing its electronic properties. PEDOT is often used in applications such as organic electronics, including organic light-emitting diodes (OLEDs), organic photovoltaics (OPVs), and as a conductive coating for various substrates. Its unique properties include high thermal stability, good mechanical flexibility, and the ability to form thin films with high optical transparency. Additionally, PEDOT can be doped with various counterions to further enhance its conductivity and tailor its properties for specific applications. The polymer is typically processed in aqueous solutions, making it environmentally friendly compared to other conductive materials. Overall, PEDOT's combination of conductivity, stability, and versatility makes it a valuable material in the field of organic electronics and beyond.
Formula:(C5H4O2S)x
InChI:InChI=1S/C5H4O2S/c1-4-5(2-8-1)7-3-6-4/h1-2H,3H2
InChI key:InChIKey=AVBCFBRGFCGJKX-UHFFFAOYSA-N
SMILES:C1=2C(OCO1)=CSC2
Synonyms:- Poly(3,4-methylenedioxythiophene)
- Thieno[3,4-d]-1,3-dioxole, homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
