CAS 1262133-30-1

8-Bromo-6-(phenylmethoxy)[1,2,4]triazolo[1,5-a]pyridine

Description:

8-Bromo-6-(phenylmethoxy)[1,2,4]triazolo[1,5-a]pyridine is a heterocyclic compound characterized by its complex structure, which includes a triazole ring fused to a pyridine moiety. The presence of a bromine atom at the 8-position and a phenylmethoxy group at the 6-position contributes to its unique chemical properties and potential biological activity. This compound is typically synthesized through multi-step organic reactions, often involving halogenation and etherification processes. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The triazole and pyridine rings are known for their roles in drug design, often exhibiting significant interactions with biological targets. Additionally, the compound's solubility, stability, and reactivity can be influenced by the substituents on the rings, making it a subject of interest for further research in both synthetic and medicinal chemistry. As with many heterocycles, its properties may also include interesting optical characteristics and potential for coordination with metal ions.

Formula: C₁₃H₁₀BrN₃O

InChI: InChI=1S/C13H10BrN3O/c14-12-6-11(7-17-13(12)15-9-16-17)18-8-10-4-2-1-3-5-10/h1-7,9H,8H2

InChI key: InChIKey=CTWJTOYZRNZVKT-UHFFFAOYSA-N

SMILES: BrC=1C=2N(C=C(OCC3=CC=CC=C3)C1)N=CN2

Synonyms:

• 8-Bromo-6-(phenylmethoxy)[1,2,4]triazolo[1,5-a]pyridine
• [1,2,4]Triazolo[1,5-a]pyridine, 8-bromo-6-(phenylmethoxy)-