CAS 1262197-31-8

2,3-Difluoro-5-methoxybenzoic acid

Description:

2,3-Difluoro-5-methoxybenzoic acid is an aromatic carboxylic acid characterized by the presence of two fluorine atoms and a methoxy group on a benzoic acid framework. The fluorine substituents are located at the 2 and 3 positions of the benzene ring, while the methoxy group is positioned at the 5 position. This compound exhibits both acidic and polar characteristics due to the carboxylic acid functional group and the electronegative fluorine atoms, which can influence its reactivity and solubility in various solvents. The presence of the methoxy group can enhance its lipophilicity, potentially affecting its biological activity and interactions. Additionally, the compound may exhibit interesting properties such as altered melting and boiling points compared to its non-fluorinated or non-methoxylated counterparts. Its unique structure makes it a candidate for various applications in pharmaceuticals, agrochemicals, and materials science, where fluorinated compounds are often sought for their enhanced stability and reactivity.

Formula: C₈H₆F₂O₃

InChI: InChI=1S/C8H6F2O3/c1-13-4-2-5(8(11)12)7(10)6(9)3-4/h2-3H,1H3,(H,11,12)

InChI key: InChIKey=UBSYJDCSWAOVCQ-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(F)C(F)=CC(OC)=C1

Synonyms:

• Benzoic acid, 2,3-difluoro-5-methoxy-
• 2,3-Difluoro-5-methoxybenzoic acid