CAS 126221-76-9
:(7Z)-7-(hydroxyimino)-6-methoxy-5-methyl-6,7,8,9,15,16-hexahydro-5H,14H-5,9-epoxy-4b,9a,15-triazadibenzo[b,h]cyclonona[1,2,3,4-jkl]cyclopenta[e]-as-indacen-14-one
Description:
The chemical substance with the name "(7Z)-7-(hydroxyimino)-6-methoxy-5-methyl-6,7,8,9,15,16-hexahydro-5H,14H-5,9-epoxy-4b,9a,15-triazadibenzo[b,h]cyclonona[1,2,3,4-jkl]cyclopenta[e]-as-indacen-14-one" and CAS number "126221-76-9" is a complex organic compound characterized by its unique structural features, including multiple fused ring systems and functional groups. The presence of a hydroxyimino group suggests potential reactivity and applications in organic synthesis or medicinal chemistry. The methoxy and methyl substituents indicate that the compound may exhibit specific electronic and steric properties, influencing its biological activity. Additionally, the triazadibenzo structure implies potential interactions with biological targets, making it of interest in pharmacological studies. Its epoxy group may also contribute to its reactivity, possibly allowing for further chemical modifications. Overall, this compound's intricate structure and functional groups suggest it may possess unique chemical properties and potential applications in various fields, including drug development and materials science.
Formula:C27H22N4O4
InChI:InChI=1/C27H22N4O4/c1-27-25(34-2)16(29-33)11-19(35-27)30-17-9-5-3-7-13(17)21-22-15(12-28-26(22)32)20-14-8-4-6-10-18(14)31(27)24(20)23(21)30/h3-10,19,25,33H,11-12H2,1-2H3,(H,28,32)/b29-16-
Synonyms:- (4Z)-4-(Hydroxyimino)-3-methoxy-2-methyl-29-oxa-1,7,17-triazaoctacyclo[12.12.2.12,6
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
