CAS 126223-29-8
:agrimonolide-6-O-glucopyranoside
Description:
Agrimonolide-6-O-glucopyranoside is a naturally occurring compound derived from the plant genus Agrimonia, known for its potential therapeutic properties. This substance is a glycoside, which means it consists of a sugar moiety (glucopyranoside) attached to a non-sugar component (agrimonolide). It exhibits various biological activities, including anti-inflammatory, antioxidant, and antimicrobial effects, making it of interest in pharmacological research. The compound is typically characterized by its solubility in polar solvents due to the presence of the glucopyranoside group, which enhances its bioavailability. Its molecular structure includes a specific arrangement of carbon, hydrogen, and oxygen atoms, contributing to its unique chemical properties. Agrimonolide-6-O-glucopyranoside is often studied for its potential applications in herbal medicine and as a lead compound for drug development, particularly in the context of traditional medicine practices. Further research is ongoing to fully elucidate its mechanisms of action and potential health benefits.
Formula:C24H28O10
InChI:InChI=1/C24H28O10/c1-31-14-5-2-12(3-6-14)4-7-15-8-13-9-16(10-17(26)19(13)23(30)32-15)33-24-22(29)21(28)20(27)18(11-25)34-24/h2-3,5-6,9-10,15,18,20-22,24-29H,4,7-8,11H2,1H3/t15-,18+,20+,21-,22+,24+/m0/s1
Synonyms:- A-6-Gp
- Agrimonolide-6-O-beta-D-glucopyranoside
- 1H-2-Benzopyran-1-one, 6-(beta-D-glucopyranosyloxy)-3,4-dihydro-8-hydroxy-3-(2-(4-methoxyphenyl)ethyl)-, (S)-
- (3S)-8-hydroxy-3-[2-(4-methoxyphenyl)ethyl]-1-oxo-3,4-dihydro-1H-isochromen-6-yl beta-D-glucopyranoside
- Agrimonolide-6-O-glucopyranoside
- (3S)-8-hydroxy-3-[2-(4-methoxyphenyl)ethyl]-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydroisochromen-1-one
- AgriMonolide 6-O-glucoside
- 1H-2-Benzopyran-1-one, 6-(β-D-glucopyranosyloxy)-3,4-dihydro-8-hydroxy-3-[2-(4-methoxyphenyl)ethyl]-, (3S)-
- Agrimonolideglucoside6-O-
- Agrimolide 6-O-glucoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(3S)-6-(β-D-Glucopyranosyloxy)-3,4-dihydro-8-hydroxy-3-[2-(4-methoxyphenyl)ethyl]-1H-2-benzopyran-1-one
CAS:Formula:C24H28O10Purity:98.5%Color and Shape:SolidMolecular weight:476.4731Agrimonolide 6-O-glucoside
CAS:Agrimonolide-6-O-glucopyranoside has antimicrobial activity.Formula:C24H28O10Purity:98%Color and Shape:SolidMolecular weight:476.478Agrimonolide 6-O-glucoside
CAS:Formula:C24H28O10Purity:95%~99%Color and Shape:PowderMolecular weight:476.478Agrimonolide 6-o-glucoside
CAS:Agrimonolide 6-O-glucoside is a glucoside compound which is derived from the plant Agrimonia, belonging to the Rosaceae family. It is structurally characterized as a flavonoid glycoside, combining both the aglycone and sugar moiety. This compound's source, Agrimonia, is traditionally known for its medicinal properties and is commonly found in temperate regions.Formula:C24H28O10Purity:Min. 95%Molecular weight:476.5 g/mol



