
CAS 1262278-59-0
:Phenylmethyl trans-3-fluorocyclobutanecarboxylate
Description:
Phenylmethyl trans-3-fluorocyclobutanecarboxylate is an organic compound characterized by its unique cyclobutane ring structure, which is substituted with a fluorine atom and an ester functional group. The presence of the phenylmethyl group contributes to its aromatic properties, while the trans configuration of the fluorocyclobutane moiety influences its stereochemistry and potentially its reactivity. This compound is likely to exhibit moderate polarity due to the ester functional group, which can engage in hydrogen bonding and dipole-dipole interactions. Its fluorine substitution may enhance lipophilicity and alter the electronic properties, making it of interest in medicinal chemistry and materials science. Additionally, the cyclobutane ring can introduce strain, which may affect the compound's stability and reactivity. Overall, Phenylmethyl trans-3-fluorocyclobutanecarboxylate represents a complex structure that could have various applications in synthetic chemistry and drug development, although specific properties such as boiling point, melting point, and solubility would require empirical measurement or detailed computational analysis for precise characterization.
Formula:C12H13FO2
InChI:InChI=1/C12H13FO2/c13-11-6-10(7-11)12(14)15-8-9-4-2-1-3-5-9/h1-5,10-11H,6-8H2/t10-,11-
InChI key:InChIKey=KWYHSQOGUKAHBZ-XYPYZODXNA-N
SMILES:C(OCC1=CC=CC=C1)(=O)[C@H]2C[C@H](F)C2
Synonyms:- Cyclobutanecarboxylic acid, 3-fluoro-, phenylmethyl ester, trans-
- Benzyl trans-3-fluorocyclobutanecarboxylate
- trans-Benzyl 3-fluorocyclobutanecarboxylate
- Phenylmethyl trans-3-fluorocyclobutanecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.