CymitQuimica logo

CAS 126230-76-0

:

Pyrimidine, 5-(bromomethyl)-, hydrobromide (1:?)

Description:
Pyrimidine, 5-(bromomethyl)-, hydrobromide (1:?) is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered heterocyclic aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a bromomethyl group at the 5-position enhances its reactivity, making it useful in various chemical syntheses. As a hydrobromide salt, it is typically encountered in a solid form, which is soluble in polar solvents such as water and alcohols. This compound may exhibit biological activity, potentially serving as an intermediate in the synthesis of pharmaceuticals or agrochemicals. Its reactivity can be attributed to the electrophilic nature of the bromomethyl group, allowing for nucleophilic substitution reactions. Safety data should be consulted, as halogenated compounds can pose health risks, including toxicity and environmental hazards. Proper handling and storage conditions are essential to ensure safety during use in laboratory or industrial settings.
Formula:C5H5BrN2·xBrH
InChI:InChI=1S/C5H5BrN2.BrH/c6-1-5-2-7-4-8-3-5;/h2-4H,1H2;1H
InChI key:InChIKey=SRWNFVXTQYUWLE-UHFFFAOYSA-N
SMILES:C(Br)C=1C=NC=NC1.Br
Synonyms:
  • Pyrimidine, 5-(bromomethyl)-, hydrobromide (1:?)
  • Pyrimidine, 5-(bromomethyl)-, hydrobromide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.