CAS 126230-91-9

1,3-Dihydro-3-methylfuro[3,4-c]pyridine

Description:

1,3-Dihydro-3-methylfuro[3,4-c]pyridine is a heterocyclic organic compound characterized by its fused ring structure, which includes both a furan and a pyridine moiety. This compound typically exhibits a pale yellow to brownish color and is soluble in organic solvents. Its molecular structure features a dihydro-pyridine ring, which contributes to its potential biological activity. The presence of the methyl group at the 3-position of the furo ring can influence its reactivity and interactions with biological targets. This compound is of interest in medicinal chemistry due to its potential pharmacological properties, including neuroprotective and anti-inflammatory effects. Additionally, its unique structure may allow for various synthetic modifications, making it a valuable scaffold in drug development. As with many heterocycles, it may also exhibit interesting electronic properties, which can be explored for applications in materials science or organic electronics. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₈H₉NO

InChI: InChI=1S/C8H9NO/c1-6-8-4-9-3-2-7(8)5-10-6/h2-4,6H,5H2,1H3

InChI key: InChIKey=RVMWPAFOLDUOTH-UHFFFAOYSA-N

SMILES: CC1C=2C(=CC=NC2)CO1

Synonyms:

• 3-Methyl-1,3-dihydrofuro[3,4-c]pyridine
• 1,3-Dihydro-3-methylfuro[3,4-c]pyridine
• Furo[3,4-c]pyridine, 1,3-dihydro-3-methyl-
• 3-Methyl-1H,3H-furo[3,4-c]pyridine