CAS 1262396-34-8

1,1-Dimethylethyl (5S)-5-(hydroxymethyl)-6-azaspiro[2.5]octane-6-carboxylate

Description:

1,1-Dimethylethyl (5S)-5-(hydroxymethyl)-6-azaspiro[2.5]octane-6-carboxylate, identified by its CAS number 1262396-34-8, is a chemical compound characterized by its unique spirocyclic structure, which includes a nitrogen atom within a bicyclic framework. This compound features a hydroxymethyl group and a tert-butyl group, contributing to its steric and electronic properties. The presence of the carboxylate functional group indicates potential for reactivity and interaction with other chemical species, making it of interest in various synthetic applications. Its stereochemistry, particularly the (5S) configuration, suggests specific spatial arrangements that can influence its biological activity and interactions. The compound may exhibit properties typical of spiro compounds, such as rigidity and potential for conformational isomerism. While specific physical properties like melting point, boiling point, and solubility are not detailed here, compounds of this nature often possess moderate to high lipophilicity, which can affect their behavior in biological systems and their utility in medicinal chemistry.

Formula: C₁₃H₂₃NO₃

InChI: InChI=1S/C13H23NO3/c1-12(2,3)17-11(16)14-7-6-13(4-5-13)8-10(14)9-15/h10,15H,4-9H2,1-3H3/t10-/m0/s1

InChI key: InChIKey=IGNPZIKVBPDVMR-JTQLQIEISA-N

SMILES: C(O)[C@@H]1CC2(CC2)CCN1C(OC(C)(C)C)=O

Synonyms:

• (S)-tert-Butyl 5-(hydroxymethyl)-6-azaspiro[2.5]octane-6-carboxylate
• 1,1-Dimethylethyl (5S)-5-(hydroxymethyl)-6-azaspiro[2.5]octane-6-carboxylate
• 6-Azaspiro[2.5]octane-6-carboxylic acid, 5-(hydroxymethyl)-, 1,1-dimethylethyl ester, (5S)-