
CAS 1262408-71-8
:1,1-Dimethylethyl 7-oxa-2-azabicyclo[4.1.0]heptane-2-carboxylate
Description:
1,1-Dimethylethyl 7-oxa-2-azabicyclo[4.1.0]heptane-2-carboxylate, identified by its CAS number 1262408-71-8, is a chemical compound characterized by its bicyclic structure, which includes a nitrogen atom and an oxygen atom within the ring system. This compound features a carboxylate functional group, contributing to its potential reactivity and solubility in various solvents. The presence of the tert-butyl group (1,1-dimethylethyl) enhances its steric bulk, which can influence its chemical behavior and interactions with other molecules. The bicyclic framework suggests potential applications in medicinal chemistry, particularly in the design of pharmaceuticals, due to its structural complexity and the ability to mimic natural products. Additionally, the compound's unique arrangement of atoms may impart specific biological activities, making it a candidate for further research in drug development. Overall, its distinctive structural features and functional groups make it a subject of interest in organic synthesis and medicinal chemistry.
Formula:C10H17NO3
InChI:InChI=1S/C10H17NO3/c1-10(2,3)14-9(12)11-6-4-5-7-8(11)13-7/h7-8H,4-6H2,1-3H3
InChI key:InChIKey=LMEUWPRMSAYCBV-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1C2C(O2)CCC1
Synonyms:- 7-Oxa-2-azabicyclo[4.1.0]heptane-2-carboxylic acid, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl 7-oxa-2-azabicyclo[4.1.0]heptane-2-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.