CAS 126245-46-3
:N-(benzylcarbamoyl)-2-cyanoacetamide
Description:
N-(Benzylcarbamoyl)-2-cyanoacetamide, identified by its CAS number 126245-46-3, is an organic compound characterized by its functional groups, which include a cyano group and a carbamoyl moiety. This compound typically appears as a solid at room temperature and is soluble in polar organic solvents. Its structure features a benzyl group attached to a carbamoyl group, which contributes to its potential reactivity and interaction with biological systems. The presence of the cyano group indicates that it may participate in nucleophilic addition reactions, making it of interest in synthetic organic chemistry. Additionally, compounds with similar structures often exhibit biological activity, which may warrant investigation for pharmaceutical applications. The compound's stability, reactivity, and potential applications can be influenced by factors such as pH, temperature, and the presence of other reactive species. As with many organic compounds, safety data should be consulted to ensure proper handling and usage in laboratory settings.
Formula:C11H11N3O2
InChI:InChI=1/C11H11N3O2/c12-7-6-10(15)14-11(16)13-8-9-4-2-1-3-5-9/h1-5H,6,8H2,(H2,13,14,15,16)
SMILES:c1ccc(cc1)CN=C(N=C(CC#N)O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
1-Benzyl-3-cyanoacetyl Urea
CAS:Controlled ProductFormula:C11H11N3O2Color and Shape:NeatMolecular weight:217.22
