CAS 126247-33-4
:5-fluoropropylepidepride
Description:
5-Fluoropropylepidepride, identified by its CAS number 126247-33-4, is a chemical compound that belongs to the class of organic molecules. While specific details about its physical and chemical properties may not be widely documented, compounds with similar structures often exhibit characteristics such as moderate to high solubility in organic solvents and potential reactivity due to the presence of fluorine, which can influence the compound's electronic properties and stability. The fluorine atom can enhance lipophilicity, potentially affecting biological interactions and pharmacokinetics if the compound is of pharmaceutical interest. Additionally, the presence of a propyl group may contribute to the compound's hydrophobic characteristics. As with many fluorinated compounds, 5-fluoropropylepidepride may also exhibit unique behavior in terms of reactivity and interaction with biological systems, making it a subject of interest in medicinal chemistry and materials science. However, specific applications, safety data, and detailed reactivity profiles would require further investigation through experimental studies and literature review.
Formula:C19H29FN2O3
InChI:InChI=1/C19H29FN2O3/c1-4-22-10-6-8-15(22)13-21-19(23)16-11-14(7-5-9-20)12-17(24-2)18(16)25-3/h11-12,15H,4-10,13H2,1-3H3,(H,21,23)
SMILES:CCN1CCCC1CN=C(c1cc(CCCF)cc(c1OC)OC)O
Synonyms:- 5-Fprepid
- N-((1-Ethyl-2-pyrrolidinyl)methyl)-5-(3-fluoropropyl)-2,3-dimethoxybenzamide
- Benzamide, N-((1-ethyl-2-pyrrolidinyl)methyl)-5-(3-fluoropropyl)-2,3-dimethoxy-, (S)-
- N-[(1-ethylpyrrolidin-2-yl)methyl]-5-(3-fluoropropyl)-2,3-dimethoxybenzamide
- 5-Fluoropropylepidepride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Benzamide, N-[[(2S)-1-ethyl-2-pyrrolidinyl]methyl]-5-(3-fluoropropyl)-2,3-dimethoxy-
CAS:Formula:C19H29FN2O3Molecular weight:352.4436
