
CAS 126253-42-7
:Icariside E4
Description:
Icariside E4 is a natural compound primarily derived from the plant species *Epimedium*, commonly known for its traditional use in herbal medicine. This compound belongs to the class of flavonoids, specifically a type of glycoside, which contributes to its bioactive properties. Icariside E4 is noted for its potential health benefits, including antioxidant, anti-inflammatory, and neuroprotective effects. It has been studied for its role in enhancing sexual health and improving bone density, making it of interest in both pharmacological and nutraceutical applications. The compound exhibits a relatively low toxicity profile, which is advantageous for its use in dietary supplements. Its mechanism of action often involves modulation of various signaling pathways, including those related to nitric oxide production and estrogenic activity. Overall, Icariside E4 represents a significant area of research in natural products chemistry, with ongoing studies aimed at elucidating its full therapeutic potential and mechanisms of action.
Formula:C26H34O10
InChI:InChI=1S/C26H34O10/c1-13-21(29)22(30)23(31)26(34-13)35-18-7-6-15(11-19(18)32-2)24-17(12-28)16-9-14(5-4-8-27)10-20(33-3)25(16)36-24/h6-7,9-11,13,17,21-24,26-31H,4-5,8,12H2,1-3H3/t13-,17+,21-,22+,23+,24-,26-/m0/s1
InChI key:InChIKey=FYWCDZKQBWSMDD-YGYBHAICSA-N
SMILES:C(O)[C@@H]1C=2C(O[C@H]1C3=CC(OC)=C(O[C@H]4[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O4)C=C3)=C(OC)C=C(CCCO)C2
Synonyms:- Icariside E4
- trans-Dihydrodehydrodiconiferyl alcohol 4′-O-α-L-rhamnopyranoside
- α-L-Mannopyranoside, 4-[(2R,3S)-2,3-dihydro-3-(hydroxymethyl)-5-(3-hydroxypropyl)-7-methoxy-2-benzofuranyl]-2-methoxyphenyl 6-deoxy-
- Dihydrodehydrodiconiferyl alcohol 9′-O-α-L-rhamnoside
- 4-[(2R,3S)-2,3-Dihydro-3-(hydroxymethyl)-5-(3-hydroxypropyl)-7-methoxy-2-benzofuranyl]-2-methoxyphenyl 6-deoxy-α-L-mannopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
α-L-Mannopyranoside, 4-[(2R,3S)-2,3-dihydro-3-(hydroxymethyl)-5-(3-hydroxypropyl)-7-methoxy-2-benzofuranyl]-2-methoxyphenyl 6-deoxy-
CAS:Formula:C26H34O10Purity:97.5%Molecular weight:506.5422Icariside E4
CAS:Icariside E4 from Ulmus minor has anti-inflammatory, antioxidant effects, targets HepG1 cells, and fights fatty liver disease.
Formula:C26H34O10Purity:98%Color and Shape:SolidMolecular weight:506.54Icariside E4
CAS:Icariside E4 is a natural bioactive compound, which is sourced from the plant genus Epimedium, commonly known as "Horny Goat Weed." It functions primarily by modulating various signaling pathways at the cellular level, including the inhibition of pro-inflammatory mediators and the activation of antioxidant defenses. This compound is noted for its potential therapeutic applications in fields such as oncology and neuroprotection.Formula:C26H34O10Purity:Min. 95%Molecular weight:506.5 g/mol


