CAS 12626-17-4
:Fumitremorgin B
Description:
Fumitremorgin B is a naturally occurring alkaloid that is primarily derived from certain species of fungi, particularly those in the Aspergillus genus. It is known for its complex structure, which includes multiple rings and functional groups that contribute to its biological activity. This compound exhibits notable pharmacological properties, including potential anti-cancer and immunosuppressive effects, making it a subject of interest in medicinal chemistry and drug development. Fumitremorgin B has been studied for its ability to inhibit specific enzymes and pathways involved in cell proliferation and survival. Its mechanism of action often involves interference with cellular signaling processes, which can lead to apoptosis in certain cancer cell lines. Additionally, due to its fungal origin, it may also possess properties that could be explored for agricultural applications, particularly in the development of natural pesticides. However, further research is necessary to fully understand its therapeutic potential and safety profile.
Formula:C27H33N3O5
InChI:InChI=1S/C27H33N3O5/c1-15(2)10-12-28-20-14-17(35-5)8-9-18(20)22-23(28)21(13-16(3)4)30-25(32)19-7-6-11-29(19)26(33)27(30,34)24(22)31/h8-10,13-14,19,21,24,31,34H,6-7,11-12H2,1-5H3/t19-,21-,24-,27+/m0/s1
InChI key:InChIKey=WEIYXEFMCIRZHC-MWGWWEMPSA-N
SMILES:C(=C(C)C)[C@H]1C2=C(C=3C(N2CC=C(C)C)=CC(OC)=CC3)[C@H](O)[C@]4(O)N1C(=O)[C@]5(N(C4=O)CCC5)[H]
Synonyms:- (5aR,6S,12S,14aS)-1,2,3,5a,6,11,12,14a-Octahydro-5a,6-dihydroxy-9-methoxy-11-(3-methyl-2-buten-1-yl)-12-(2-methyl-1-propen-1-yl)-5H,14H-pyrrolo[1′′,2′′:4′,5′]pyrazino[1′,2′:1,6]pyrido[3,4-b]indole-5,14-dione
- (5aR,6S,12S,14aS)-5a,6-dihydroxy-9-methoxy-11-(3-methylbut-2-en-1-yl)-12-(2-methylprop-1-en-1-yl)-1,2,3,5a,6,11,12,14a-octahydro-5H,14H-pyrrolo[1'',2'':4',5']pyrazino[1',2':1,6]pyrido[3,4-b]indole-5,14-dione
- 5H,14H-Pyrrolo[1′′,2′′:4′,5′]pyrazino[1′,2′:1,6]pyrido[3,4-b]indole-5,14-dione, 1,2,3,5a,6,11,12,14a-octahydro-5a,6-dihydroxy-9-methoxy-11-(3-methyl-2-buten-1-yl)-12-(2-methyl-1-propen-1-yl)-, (5aR,6S,12S,14aS)-
- 5H,14H-Pyrrolo[1′′,2′′:4′,5′]pyrazino[1′,2′:1,6]pyrido[3,4-b]indole-5,14-dione, 1,2,3,5a,6,11,12,14a-octahydro-5a,6-dihydroxy-9-methoxy-11-(3-methyl-2-butenyl)-12-(2-methyl-1-propenyl)-, (5aR,6S,12S,14aS)-
- 5H,14H-Pyrrolo[1′′,2′′:4′,5′]pyrazino[1′,2′:1,6]pyrido[3,4-b]indole-5,14-dione, 1,2,3,5a,6,11,12,14a-octahydro-5a,6-dihydroxy-9-methoxy-11-(3-methyl-2-butenyl)-12-(2-methyl-1-propenyl)-, [5aR-(5aα,6α,12β,14aα)]-
- Fumitremorgenb
- Lanosulin
- Na 209B
- Fumitremorgin B
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Fumitremorgin B
CAS:<p>Fumitremorgin B: mycotoxin, genotoxic, DNA damaging, inhibits cell cycle in mice, anti-fungal, toxic to brine shrimps, deters armyworm feeding.</p>Formula:C27H33N3O5Purity:98%Color and Shape:SolidMolecular weight:479.57Fumitremorgin B
CAS:<p>Fumitremorgin B is a mycotoxin, which is a small molecule metabolite derived from certain fungi, specifically belonging to the Aspergillus species. This compound is classified as an indole alkaloid and is produced through the secondary metabolic pathways of these fungal organisms. Fumitremorgin B acts primarily by inhibiting the function of ATP-binding cassette (ABC) transporters, which are integral membrane proteins involved in the translocation of various substrates across cellular membranes.</p>Formula:C27H33N3O5Purity:Min. 95%Molecular weight:479.57 g/mol


