
CAS 1262616-92-1
:(3E)-3-[(2-Bromophenyl)methylene]-2,3-dihydro-4H-1-benzopyran-4-one
Description:
The chemical substance known as (3E)-3-[(2-Bromophenyl)methylene]-2,3-dihydro-4H-1-benzopyran-4-one, with the CAS number 1262616-92-1, is a synthetic organic compound characterized by its complex structure, which includes a benzopyran core. This compound features a methylene bridge connecting a 2-bromophenyl group, contributing to its potential reactivity and biological activity. The presence of the bromine atom enhances its electrophilic character, making it a candidate for various chemical reactions, including nucleophilic substitutions. The benzopyran moiety is known for its occurrence in many natural products and its diverse pharmacological properties, including antioxidant and anti-inflammatory activities. The compound's stereochemistry, indicated by the (3E) configuration, suggests specific spatial arrangements that can influence its interactions with biological targets. Overall, this compound may be of interest in medicinal chemistry and materials science due to its unique structural features and potential applications.
Formula:C16H11BrO2
InChI:InChI=1S/C16H11BrO2/c17-14-7-3-1-5-11(14)9-12-10-19-15-8-4-2-6-13(15)16(12)18/h1-9H,10H2/b12-9+
InChI key:InChIKey=DKECTQZJNQHCKP-FMIVXFBMSA-N
SMILES:O=C\1C=2C(OC/C1=C\C3=C(Br)C=CC=C3)=CC=CC2
Synonyms:- 4H-1-Benzopyran-4-one, 3-[(2-bromophenyl)methylene]-2,3-dihydro-, (3E)-
- (3E)-3-[(2-Bromophenyl)methylene]-2,3-dihydro-4H-1-benzopyran-4-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.