CAS 126268-81-3
:Mivobulin isethionate
Description:
Mivobulin isethionate is a synthetic compound primarily known for its application in the field of pharmacology, particularly as an antitumor agent. It belongs to the class of microtubule inhibitors, which function by disrupting the normal assembly and disassembly of microtubules, thereby inhibiting cell division. This mechanism makes it a candidate for cancer treatment, as it can target rapidly dividing cells. The isethionate salt form enhances its solubility and stability, which is crucial for its bioavailability and therapeutic efficacy. Mivobulin is characterized by its specific molecular structure, which includes a core that interacts with tubulin, the protein that forms microtubules. Its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion, are essential for determining its clinical use and dosage. As with many chemotherapeutic agents, potential side effects may include toxicity to normal cells, necessitating careful monitoring during treatment. Overall, Mivobulin isethionate represents a significant advancement in targeted cancer therapies, with ongoing research to optimize its use in clinical settings.
Formula:C17H19N5O2·C2H6O4S
InChI:InChI=1/C17H19N5O2.C2H6O4S/c1-3-24-17(23)21-13-9-12-15(16(18)20-13)22-14(10(2)19-12)11-7-5-4-6-8-11;3-1-2-7(4,5)6/h4-10,19H,3H2,1-2H3,(H3,18,20,21,23);3H,1-2H2,(H,4,5,6)/t10-;/m0./s1
Synonyms:- Ethyl N-[(9S)-5-amino-9-methyl-8-phenyl-4,7,10-triazabicyclo[4.4.0] deca-1,3,5,7-tetraen-3-yl]carbamate 2-hydroxyethanesulfonic acid salt
- 2-hydroxyethanesulfonic acid - ethyl [(2S)-5-amino-2-methyl-3-phenyl-1,2-dihydropyrido[3,4-b]pyrazin-7-yl]carbamate (1:1)
- NSC-613863
- Mivobulin isethionate ISO 9001:2015 REACH
- NSC-635370
- ethylN-[(2S)-5-amino-2-methyl-3-phenyl-1,2-dihydropyrido[3,4-b]pyrazin-7-yl]carbamate,2-hydroxyethanesulfonicaci
- Mivobulin isethionate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Mivobulin Isethionate
CAS:Controlled ProductFormula:C17H19N5O2·C2H6O4SColor and Shape:NeatMolecular weight:451.497Mivobulin Isethionate
CAS:Mivobulin, a tubulin inhibitor (CI-980), may treat glioma, melanoma, prostate, and ovarian cancer, targeting colchicine-binding site.Formula:C19H25N5O6SPurity:98%Color and Shape:SolidMolecular weight:451.5

