CAS 1262757-36-7

1,1-Dimethylethyl 9-fluoro-4,5-dihydrospiro[1,5-benzoxazepine-2(3H),4′-piperidine]-1′-carboxylate

Description:

1,1-Dimethylethyl 9-fluoro-4,5-dihydrospiro[1,5-benzoxazepine-2(3H),4′-piperidine]-1′-carboxylate, identified by its CAS number 1262757-36-7, is a complex organic compound characterized by its unique spirocyclic structure, which combines elements of benzoxazepine and piperidine. This compound features a 9-fluoro substituent, contributing to its potential biological activity. The presence of the dimethylethyl group indicates steric hindrance, which may influence its reactivity and interaction with biological targets. The carboxylate functional group suggests potential for forming salts or participating in esterification reactions. Such compounds are often of interest in medicinal chemistry due to their structural diversity and potential pharmacological properties. The specific arrangement of atoms and functional groups in this molecule may confer unique properties, making it a candidate for further research in drug development or as a biochemical probe. However, detailed studies would be necessary to elucidate its full chemical behavior and potential applications.

Formula: C₁₈H₂₅FN₂O₃

InChI: InChI=1S/C18H25FN2O3/c1-17(2,3)24-16(22)21-11-8-18(9-12-21)7-10-20-14-6-4-5-13(19)15(14)23-18/h4-6,20H,7-12H2,1-3H3

InChI key: InChIKey=FRWLOLNMKKCCNA-UHFFFAOYSA-N

SMILES: FC1=C2OC3(CCN(C(OC(C)(C)C)=O)CC3)CCNC2=CC=C1

Synonyms:

• Spiro[1,5-benzoxazepine-2(3H),4′-piperidine]-1′-carboxylic acid, 9-fluoro-4,5-dihydro-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 9-fluoro-4,5-dihydrospiro[1,5-benzoxazepine-2(3H),4′-piperidine]-1′-carboxylate