CAS 1262769-95-8

3-Pyrrolidinol, 4-(1-methylethoxy)-, hydrochloride (1:1), (3R,4R)-rel-

Description:

3-Pyrrolidinol, 4-(1-methylethoxy)-, hydrochloride (1:1), (3R,4R)-rel- is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. The presence of the 1-methylethoxy group indicates that it has an ether functional group, contributing to its solubility and reactivity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form. The (3R,4R)-rel- designation indicates specific stereochemistry, which can influence the compound's biological activity and interaction with receptors. This compound may exhibit properties relevant to medicinal chemistry, potentially serving as a precursor or intermediate in the synthesis of pharmaceuticals. Its specific characteristics, such as melting point, boiling point, and spectral data, would be determined through experimental methods. Overall, this compound's unique structure and properties make it of interest in various chemical and pharmaceutical applications.

Formula: C₇H₁₅NO₂·ClH

InChI: InChI=1/C7H15NO2.ClH/c1-5(2)10-7-4-8-3-6(7)9;/h5-9H,3-4H2,1-2H3;1H/t6-,7-;/s2

InChI key: InChIKey=ZDRUVKNQNJRWJV-NSLAZIKQNA-N

SMILES: O(C(C)C)[C@@H]1[C@@H](O)CNC1.Cl

Synonyms:

• 3-Pyrrolidinol, 4-(1-methylethoxy)-, hydrochloride (1:1), (3R,4R)-rel-

(3S,4S)-4-isopropoxy-3-pyrrolidinol hydrochloride

CAS: 1262769-95-8

Formula: C₇H₁₆ClNO₂

Purity: 95.0%

Molecular weight: 181.66

Ref: 10-F360241