CymitQuimica logo

CAS 1262771-04-9

:

4-Piperidineethanimidamide, 1-methyl-, hydrochloride (1:1)

Description:
4-Piperidineethanimidamide, 1-methyl-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which contributes to its basicity and potential biological activity. The presence of the ethanimidamide functional group suggests that it may exhibit properties related to amide chemistry, such as hydrogen bonding and reactivity with electrophiles. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals. The compound may be of interest in medicinal chemistry due to its structural features that could interact with biological targets. Its molecular interactions may involve mechanisms such as enzyme inhibition or receptor modulation, making it a candidate for further research in drug development. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Overall, 4-Piperidineethanimidamide, 1-methyl-, hydrochloride (1:1) represents a unique structure with potential implications in chemical and biological research.
Formula:C8H17N3·ClH
InChI:InChI=1S/C8H17N3.ClH/c1-11-4-2-7(3-5-11)6-8(9)10;/h7H,2-6H2,1H3,(H3,9,10);1H
InChI key:InChIKey=TXZIIAMCUHSVRN-UHFFFAOYSA-N
SMILES:C(C(=N)N)C1CCN(C)CC1.Cl
Synonyms:
  • 4-Piperidineethanimidamide, 1-methyl-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.