CAS 1262771-70-9

3-Cycloheptapyrazolemethanamine, 1,4,5,6,7,8-hexahydro-, hydrochloride (1:2)

Description:

3-Cycloheptapyrazolemethanamine, 1,4,5,6,7,8-hexahydro-, hydrochloride (1:2) is a chemical compound characterized by its unique bicyclic structure, which includes a cycloheptane ring fused with a pyrazole moiety. This compound typically exists as a hydrochloride salt, enhancing its solubility in polar solvents, which is a common feature for many amines. The presence of multiple nitrogen atoms in its structure suggests potential biological activity, possibly influencing its pharmacological properties. The hexahydro configuration indicates that the compound is fully saturated, which may contribute to its stability and reactivity. As a hydrochloride salt, it is likely to exhibit improved stability and handling characteristics compared to its free base form. The compound's specific applications and biological activities would depend on its interaction with various biological targets, making it of interest in medicinal chemistry and drug development. However, detailed studies would be necessary to elucidate its full range of properties and potential uses.

Formula: C₉H₁₅N₃.2ClH

InChI: InChI=1S/C9H15N3.2ClH/c10-6-9-7-4-2-1-3-5-8(7)11-12-9;;/h1-6,10H2,(H,11,12);2*1H

InChI key: InChIKey=KLHYYIDOHMBNOC-UHFFFAOYSA-N

SMILES: C(N)C=1C2=C(NN1)CCCCC2.Cl

(1,4,5,6,7,8-hexahydrocyclohepta[c]pyrazol-3-ylmethyl)amine dihydrochloride

CAS: 1262771-70-9

Formula: C₉H₁₇Cl₂N₃

Purity: 95.0%

Molecular weight: 238.16

Ref: 10-F308419