CymitQuimica logo

CAS 1262771-76-5

:

2,8-Diazaspiro[5.5]undecane, 2-(phenylmethyl)-, hydrochloride (1:2)

Description:
2,8-Diazaspiro[5.5]undecane, 2-(phenylmethyl)-, hydrochloride (1:2) is a chemical compound characterized by its unique spirocyclic structure, which features two nitrogen atoms incorporated into a bicyclic framework. This compound is a hydrochloride salt, indicating that it is typically encountered in a protonated form, enhancing its solubility in polar solvents like water. The presence of the phenylmethyl group contributes to its potential for various interactions, including hydrophobic and π-π stacking interactions, which may influence its biological activity. The compound's structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting central nervous system disorders. Its specific stereochemistry and functional groups may also play a crucial role in determining its pharmacokinetic and pharmacodynamic properties. As with many nitrogen-containing heterocycles, it may exhibit interesting reactivity and stability under various conditions, making it a subject of interest in both synthetic and medicinal chemistry research.
Formula:C16H24N2·2ClH
InChI:InChI=1S/C16H24N2.2ClH/c1-2-6-15(7-3-1)12-18-11-5-9-16(14-18)8-4-10-17-13-16;;/h1-3,6-7,17H,4-5,8-14H2;2*1H
InChI key:InChIKey=NPMMKYAIZKMXND-UHFFFAOYSA-N
SMILES:C(N1CC2(CCC1)CCCNC2)C3=CC=CC=C3.Cl
Synonyms:
  • 2,8-Diazaspiro[5.5]undecane, 2-(phenylmethyl)-, hydrochloride (1:2)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.