CAS 1262771-88-9

1H-Imidazole-1-propanoic acid, 2-ethyl-, hydrate (1:1)

Description:

1H-Imidazole-1-propanoic acid, 2-ethyl-, hydrate (1:1) is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a propanoic acid moiety, contributing to its acidic properties, and an ethyl group that enhances its hydrophobic characteristics. The hydrate form indicates that the compound contains water molecules in its crystalline structure, which can influence its solubility and stability. Typically, compounds like this may exhibit biological activity, potentially serving as intermediates in pharmaceutical synthesis or as active ingredients in various applications. The presence of the imidazole ring suggests potential interactions with biological systems, particularly in enzyme catalysis or as ligands in coordination chemistry. Its CAS number, 1262771-88-9, allows for precise identification in chemical databases, facilitating research and application in various scientific fields. Overall, this compound's unique structure and properties make it of interest in both organic chemistry and medicinal chemistry contexts.

Formula: C₈H₁₂N₂O₂·H₂O

InChI: InChI=1S/C8H12N2O2.H2O/c1-2-7-9-4-6-10(7)5-3-8(11)12;/h4,6H,2-3,5H2,1H3,(H,11,12);1H2

InChI key: InChIKey=NATLRXUXJKWBMP-UHFFFAOYSA-N

SMILES: C(CC(O)=O)N1C(CC)=NC=C1.O

Synonyms:

• 1H-Imidazole-1-propanoic acid, 2-ethyl-, hydrate (1:1)

3-(2-ethyl-1H-imidazol-1-yl)propanoic acid hydrate

CAS: 1262771-88-9

Formula: C₈H₁₄N₂O₃

Purity: 95.0%

Molecular weight: 186.211

Ref: 10-F358837