CAS 1262772-00-8

Pyrazolo[1,5-a]pyrimidin-3-amine, 4,5,6,7-tetrahydro-, hydrochloride (1:1)

Description:

Pyrazolo[1,5-a]pyrimidin-3-amine, 4,5,6,7-tetrahydro-, hydrochloride (1:1) is a chemical compound characterized by its unique bicyclic structure, which incorporates both pyrazole and pyrimidine moieties. This compound typically appears as a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the presence of the hydrochloride salt form. The tetrahydro configuration indicates that it has undergone partial saturation, which can influence its reactivity and biological activity. Pyrazolo[1,5-a]pyrimidines are of interest in medicinal chemistry, often exhibiting potential pharmacological properties, including anti-inflammatory and anticancer activities. The presence of the amine group enhances its ability to form hydrogen bonds, which can be crucial for interactions with biological targets. As with many chemical substances, safety data should be consulted, as it may pose hazards if not handled properly. Overall, this compound represents a significant area of research in drug development and synthetic chemistry.

Formula: C₆H₁₀N₄·ClH

InChI: InChI=1S/C6H10N4.ClH/c7-5-4-9-10-3-1-2-8-6(5)10;/h4,8H,1-3,7H2;1H

InChI key: InChIKey=SQUYNDFXZPKERI-UHFFFAOYSA-N

SMILES: NC1=C2N(CCCN2)N=C1.Cl

Synonyms:

• Pyrazolo[1,5-a]pyrimidin-3-amine, 4,5,6,7-tetrahydro-, hydrochloride (1:1)