CAS 1262860-50-3

5-(Difluoromethoxy)-3-methyl-2-pyridinecarboxylic acid

Description:

5-(Difluoromethoxy)-3-methyl-2-pyridinecarboxylic acid is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a difluoromethoxy group indicates that the compound has two fluorine atoms attached to a methoxy group (-O-CH2F) at the 5-position of the pyridine ring. Additionally, a methyl group is present at the 3-position, while a carboxylic acid functional group (-COOH) is located at the 2-position. This combination of functional groups contributes to the compound's potential polarity and solubility in various solvents. The difluoromethoxy group may enhance the compound's biological activity or influence its reactivity due to the electronegative fluorine atoms. The carboxylic acid group can participate in hydrogen bonding, affecting the compound's interactions in biological systems. Overall, this compound may have applications in pharmaceuticals or agrochemicals, although specific biological or chemical properties would require further investigation.

Formula: C₈H₇F₂NO₃

InChI: InChI=1S/C8H7F2NO3/c1-4-2-5(14-8(9)10)3-11-6(4)7(12)13/h2-3,8H,1H3,(H,12,13)

InChI key: InChIKey=BJSGKNMBNWQGOX-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(C)C=C(OC(F)F)C=N1

Synonyms:

• 5-(Difluoromethoxy)-3-methyl-2-pyridinecarboxylic acid
• 5-Difluoromethoxy-3-methyl-pyridine-2-carboxylic acid
• 5-(Difluoromethoxy)-3-methylpicolinic acid
• 2-Pyridinecarboxylic acid, 5-(difluoromethoxy)-3-methyl-