CAS 1262860-51-4
:5-(Difluoromethoxy)-3-methyl-2-pyridinecarbonitrile
Description:
5-(Difluoromethoxy)-3-methyl-2-pyridinecarbonitrile is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a difluoromethoxy group and a cyano group. The presence of the difluoromethoxy moiety contributes to its potential as a polar compound, influencing its solubility and reactivity. The methyl group at the 3-position of the pyridine ring can affect the compound's electronic properties and steric hindrance. This compound is likely to exhibit moderate to high stability under standard conditions, but its reactivity may vary depending on the presence of functional groups and the reaction environment. It may also possess interesting biological activities, making it a candidate for further research in medicinal chemistry. The CAS number 1262860-51-4 uniquely identifies this compound, facilitating its recognition in scientific literature and databases. Overall, its distinctive functional groups and structural features suggest potential applications in pharmaceuticals or agrochemicals.
Formula:C8H6F2N2O
InChI:InChI=1S/C8H6F2N2O/c1-5-2-6(13-8(9)10)4-12-7(5)3-11/h2,4,8H,1H3
InChI key:InChIKey=FUOAWQNATGLZFF-UHFFFAOYSA-N
SMILES:C(#N)C1=C(C)C=C(OC(F)F)C=N1
Synonyms:- 5-(Difluoromethoxy)-3-methylpicolinonitrile
- 2-Pyridinecarbonitrile, 5-(difluoromethoxy)-3-methyl-
- 5-Difluoromethoxy-3-methyl-pyridine-2-carbonitrile
- 5-(Difluoromethoxy)-3-methyl-2-pyridinecarbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
