CAS 1262860-55-8

Methyl 5-(2-methoxyethoxy)-2-pyridinecarboxylate

Description:

Methyl 5-(2-methoxyethoxy)-2-pyridinecarboxylate is an organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a carboxylate functional group, specifically an ester, indicated by the presence of the methyl ester moiety. The substituent 2-methoxyethoxy group contributes to its solubility and reactivity, enhancing its potential applications in organic synthesis and medicinal chemistry. The presence of the methoxy and ethoxy groups suggests that the compound may exhibit interesting polar characteristics, influencing its interaction with biological systems or other chemical entities. Additionally, the pyridine ring can participate in various chemical reactions, making this compound a versatile intermediate in the synthesis of more complex molecules. Its specific properties, such as boiling point, melting point, and solubility, would depend on the molecular interactions and the overall structure, which can be further explored through experimental characterization or computational modeling.

Formula: C₁₀H₁₃NO₄

InChI: InChI=1S/C10H13NO4/c1-13-5-6-15-8-3-4-9(11-7-8)10(12)14-2/h3-4,7H,5-6H2,1-2H3

InChI key: InChIKey=DQRXMMCTYRVWKZ-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=CC=C(OCCOC)C=N1

Synonyms:

• 2-Pyridinecarboxylic acid, 5-(2-methoxyethoxy)-, methyl ester
• Methyl 5-(2-methoxyethoxy)-2-pyridinecarboxylate