
CAS 1262865-35-9
:1-(2,2-Difluoroethyl)-1H-pyrazole-5-methanol
Description:
1-(2,2-Difluoroethyl)-1H-pyrazole-5-methanol is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted with a difluoroethyl group and a hydroxymethyl group. This compound typically exhibits properties associated with both the pyrazole moiety and the functional groups attached to it. Pyrazoles are known for their diverse biological activities, making this compound of interest in medicinal chemistry. The presence of the difluoroethyl group may enhance lipophilicity and influence the compound's interaction with biological targets. Additionally, the hydroxymethyl group can participate in hydrogen bonding, potentially affecting solubility and reactivity. The compound's CAS number, 1262865-35-9, allows for precise identification in chemical databases. Overall, 1-(2,2-Difluoroethyl)-1H-pyrazole-5-methanol is a compound that may possess interesting pharmacological properties, warranting further investigation in drug development and related fields.
Formula:C6H8F2N2O
InChI:InChI=1S/C6H8F2N2O/c7-6(8)3-10-5(4-11)1-2-9-10/h1-2,6,11H,3-4H2
InChI key:InChIKey=ZKKQHEKWFHBESP-UHFFFAOYSA-N
SMILES:C(C(F)F)N1C(CO)=CC=N1
Synonyms:- 1-(2,2-Difluoroethyl)-1H-pyrazole-5-methanol
- 1H-Pyrazole-5-methanol, 1-(2,2-difluoroethyl)-
- [1-(2,2-Difluoroethyl)-1H-pyrazol-5-yl]methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.