CAS 1262865-38-2
:1-Ethyl-1H-pyrazole-5-ethanamine
Description:
1-Ethyl-1H-pyrazole-5-ethanamine is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features an ethyl group and an ethanamine substituent, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the amine functional group suggests that it may exhibit basic properties and can participate in hydrogen bonding, making it potentially soluble in polar solvents. Its molecular structure allows for various applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. Additionally, the compound may exhibit interesting reactivity patterns, making it a candidate for further research in synthetic chemistry. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C7H13N3
InChI:InChI=1S/C7H13N3/c1-2-10-7(3-5-8)4-6-9-10/h4,6H,2-3,5,8H2,1H3
InChI key:InChIKey=FGIBXJBTJBRRHX-UHFFFAOYSA-N
SMILES:C(CN)C=1N(CC)N=CC1
Synonyms:- 1-Ethyl-1H-pyrazole-5-ethanamine
- 1H-Pyrazole-5-ethanamine, 1-ethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.