CymitQuimica logo

CAS 1262886-66-7

:

(2R)-2-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]nonanoic acid

Description:
(2R)-2-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]nonanoic acid, commonly referred to as Fmoc-nonanoic acid, is a synthetic amino acid derivative characterized by its unique structure that includes a nonanoic acid backbone and a fluorenylmethoxycarbonyl (Fmoc) protecting group. This compound is typically used in peptide synthesis, particularly in solid-phase peptide synthesis (SPPS), where the Fmoc group serves as a protective moiety for the amino group, allowing for selective coupling reactions. The presence of the nonanoic acid chain contributes to the hydrophobic properties of the molecule, influencing the overall solubility and stability of the peptides formed. Additionally, the Fmoc group can be easily removed under mild basic conditions, facilitating the sequential addition of amino acids during synthesis. The compound is generally stable under standard laboratory conditions but should be handled with care due to its potential reactivity in certain chemical environments. Its applications extend to biochemistry and pharmaceutical research, where it plays a crucial role in the development of peptide-based therapeutics.
Formula:C24H29NO4
InChI:InChI=1S/C24H29NO4/c1-2-3-4-5-6-15-22(23(26)27)25-24(28)29-16-21-19-13-9-7-11-17(19)18-12-8-10-14-20(18)21/h7-14,21-22H,2-6,15-16H2,1H3,(H,25,28)(H,26,27)/t22-/m1/s1
InChI key:InChIKey=GUZDXKHXLJQSLH-JOCHJYFZSA-N
SMILES:C(OC(N[C@H](CCCCCCC)C(O)=O)=O)C1C=2C(C=3C1=CC=CC3)=CC=CC2
Synonyms:
  • (2R)-2-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]nonanoic acid
  • (r)-2-[(9-Fluorenylmethoxycarbonyl)amino]nonanoic acid
  • Nonanoic acid, 2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-, (2R)-
Found 3 products.