CAS 126294-30-2
:Sagandipine
Description:
Sagandipine is a chemical compound classified as a selective antagonist of the calcium channel, primarily targeting the L-type calcium channels. It is known for its potential applications in the treatment of cardiovascular diseases, particularly hypertension, due to its ability to inhibit calcium influx in vascular smooth muscle cells, leading to vasodilation. The compound has a unique molecular structure that contributes to its pharmacological properties, including its lipophilicity and ability to cross biological membranes. Sagandipine has been studied for its effects on blood pressure regulation and may also exhibit neuroprotective properties. Its safety profile and efficacy in clinical settings are subjects of ongoing research. As with many pharmacological agents, the specific characteristics, including solubility, stability, and metabolic pathways, are critical for its therapeutic application and development. Overall, Sagandipine represents a significant area of interest in medicinal chemistry and pharmacology, particularly in the context of cardiovascular health.
Formula:C27H31FN2O5
InChI:InChI=1/C27H31FN2O5/c1-17-23(26(31)33-3)25(21-9-5-6-10-22(21)28)24(18(2)29-17)27(32)34-16-20-12-11-19(35-20)15-30-13-7-4-8-14-30/h5-6,9-12,25,29H,4,7-8,13-16H2,1-3H3
SMILES:CC1=C(C(c2ccccc2F)C(=C(C)N1)C(=O)OCc1ccc(CN2CCCCC2)o1)C(=O)OC
Synonyms:- Sagandipine [INN]
- Methyl (5-piperidinomethyl)furfuryl 4-(o-fluorophenyl)-1,4-dihydro-2,6-dimethyl-3,5-pyridinedicarboxylate
- Unii-20O65J0B72
- Methyl [5-(Piperidin-1-Ylmethyl)Furan-2-Yl]Methyl 4-(2-Fluorophenyl)-2,6-Dimethyl-1,4-Dihydropyridine-3,5-Dicarboxylate
- Sagandipine
- 3,5-Pyridinedicarboxylic acid, 4-(2-fluorophenyl)-1,4-dihydro-2,6-dimethyl-, 3-methyl 5-[[5-(1-piperidinylmethyl)-2-furanyl]methyl] ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
