CymitQuimica logo

CAS 126296-29-5

:

2,3,5,6-tetrafluorophenyl-5-iodo-4-pentenoate

Description:
2,3,5,6-Tetrafluorophenyl-5-iodo-4-pentenoate is a chemical compound characterized by its complex structure, which includes a pentenoate moiety and multiple halogen substituents on a phenyl ring. The presence of four fluorine atoms on the phenyl group significantly influences its chemical properties, enhancing its reactivity and polarity. The iodine atom introduces additional reactivity, making it a potential candidate for various synthetic applications, including in organic synthesis and medicinal chemistry. This compound is likely to exhibit unique spectroscopic properties due to the halogen substituents, which can affect its UV-Vis absorption and NMR characteristics. Its molecular structure suggests potential applications in the development of pharmaceuticals or agrochemicals, where halogenated compounds are often utilized for their biological activity. Additionally, the presence of the pentenoate group may allow for further functionalization, making it a versatile intermediate in chemical synthesis. Safety and handling precautions should be observed due to the presence of halogens, which can pose health and environmental risks.
Formula:C11H7F4IO2
InChI:InChI=1/C11H7F4IO2/c12-6-5-7(13)10(15)11(9(6)14)18-8(17)3-1-2-4-16/h2,4-5H,1,3H2/b4-2+
Synonyms:
  • 2,3,5,6-Tfpip
  • 4-Pentenoic acid, 5-iodo-, 2,3,5,6-tetrafluorophenyl ester
  • 2,3,5,6-tetrafluorophenyl (4E)-5-iodopent-4-enoate
  • 2,3,5,6-Tetrafluorophenyl 5-iodo-4-pentenoate
  • 2,3,5,6-Tetrafluorophenyl-5-iodo-4-pentenoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.