CymitQuimica logo

CAS 1262988-78-2

:

4-(Acetyloxy)-1-(phenylmethyl)-4-piperidinecarboxylic acid

Description:
4-(Acetyloxy)-1-(phenylmethyl)-4-piperidinecarboxylic acid, with the CAS number 1262988-78-2, is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features an acetyloxy group and a phenylmethyl substituent, contributing to its potential biological activity. The presence of the carboxylic acid functional group indicates that it can participate in acid-base reactions and may exhibit polar characteristics, influencing its solubility in various solvents. The acetyloxy group can enhance the compound's lipophilicity, potentially affecting its pharmacokinetic properties. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties could be further explored through spectroscopic methods and biological assays to assess its efficacy and safety in potential applications.
Formula:C15H19NO4
InChI:InChI=1S/C15H19NO4/c1-12(17)20-15(14(18)19)7-9-16(10-8-15)11-13-5-3-2-4-6-13/h2-6H,7-11H2,1H3,(H,18,19)
InChI key:InChIKey=QENYHVSLURAURH-UHFFFAOYSA-N
SMILES:O(C(C)=O)C1(C(O)=O)CCN(CC2=CC=CC=C2)CC1
Synonyms:
  • 4-Piperidinecarboxylic acid, 4-(acetyloxy)-1-(phenylmethyl)-
  • 4-(Acetyloxy)-1-(phenylmethyl)-4-piperidinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.