CymitQuimica logo

CAS 1263002-80-7

:

(3S)-3-Methyl-2-azaspiro[4.4]nonane

Description:
(3S)-3-Methyl-2-azaspiro[4.4]nonane is a bicyclic organic compound characterized by its unique spiro structure, which consists of a nitrogen atom integrated into a bicyclic framework. This compound features a chiral center at the 3-position, contributing to its stereochemistry and potentially influencing its biological activity. The presence of the azaspiro moiety indicates that it contains both nitrogen and carbon atoms arranged in a specific spatial configuration, which can affect its reactivity and interactions with other molecules. Typically, such compounds may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The molecular structure suggests potential applications in drug development, particularly in areas where spirocyclic compounds are known to play a role in modulating biological pathways. Additionally, the compound's solubility, stability, and reactivity can vary based on its functional groups and overall molecular architecture, which are critical for understanding its behavior in different chemical environments.
Formula:C9H17N
InChI:InChI=1S/C9H17N/c1-8-6-9(7-10-8)4-2-3-5-9/h8,10H,2-7H2,1H3/t8-/m0/s1
InChI key:InChIKey=NPBBRURTAYRIQO-QMMMGPOBSA-N
SMILES:C[C@H]1CC2(CCCC2)CN1
Synonyms:
  • (3S)-3-Methyl-2-azaspiro[4.4]nonane
  • 2-Azaspiro[4.4]nonane, 3-methyl-, (3S)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.