CAS 126301-16-4

(2S)-2-[(tert-butoxycarbonyl)amino]propyl methanesulfonate

Description:

(2S)-2-[(tert-butoxycarbonyl)amino]propyl methanesulfonate, with CAS number 126301-16-4, is a chemical compound that features a chiral center, indicating it exists in two enantiomeric forms. This substance is characterized by the presence of a tert-butoxycarbonyl (Boc) protecting group, which is commonly used in organic synthesis to protect amines during chemical reactions. The methanesulfonate group serves as a leaving group, making the compound useful in nucleophilic substitution reactions. The compound is typically a white to off-white solid and is soluble in polar organic solvents. Its applications are primarily found in the field of organic chemistry, particularly in peptide synthesis and other synthetic pathways where selective reactivity is desired. The presence of the sulfonate group enhances the compound's reactivity, allowing for further functionalization. As with many chemical substances, proper handling and safety precautions should be observed due to potential hazards associated with its use.

Formula: C₉H₁₉NO₅S

InChI: InChI=1/C9H19NO5S/c1-7(6-14-16(5,12)13)10-8(11)15-9(2,3)4/h7H,6H2,1-5H3,(H,10,11)/t7-/m0/s1

SMILES: C[C@@H](COS(=O)(=O)C)N=C(O)OC(C)(C)C

Synonyms:

• (2S)-2-[(tert-Butoxycarbonyl)amino]propyl methanesulfonate

(S)-Methanesulphonic acid 2-Boc-aminopropyl ester

CAS: 126301-16-4

Purity: 99.0%

Color and Shape: Solid, Crystalline

Molecular weight: 253.30999755859375

Ref: 10-F047948

(S)-Methanesulphonic acid 2-Boc-aminopropyl ester

CAS: 126301-16-4

Formula: C₉H₁₉NO₅S

Purity: 95%

Color and Shape: Solid

Molecular weight: 253.3159

Ref: IN-DA009DRO

tert-Butyl N-[(2S)-1-(methanesulfonyloxy)propan-2-yl]carbamate

CAS: 126301-16-4

tert-Butyl N-[(2S)-1-(methanesulfonyloxy)propan-2-yl]carbamate

Molecular weight: 253.31586g/mol

Ref: 54-OR1022460