
CAS 1263057-89-1
:4-Fluoro-2-iodo-1-(trifluoromethoxy)benzene
Description:
4-Fluoro-2-iodo-1-(trifluoromethoxy)benzene is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a fluorine atom, an iodine atom, and a trifluoromethoxy group. The presence of the trifluoromethoxy group contributes to its unique chemical properties, enhancing its reactivity and solubility in various solvents. This compound is likely to exhibit significant polarity due to the electronegative fluorine and iodine substituents, which can influence its interactions in chemical reactions and biological systems. Additionally, the presence of multiple halogen atoms may impart interesting electronic properties, making it a potential candidate for applications in pharmaceuticals, agrochemicals, or materials science. Its synthesis and handling require careful consideration of safety protocols due to the reactivity of halogenated compounds. Overall, 4-Fluoro-2-iodo-1-(trifluoromethoxy)benzene represents a complex molecule with potential utility in various chemical applications.
Formula:C7H3F4IO
InChI:InChI=1S/C7H3F4IO/c8-4-1-2-6(5(12)3-4)13-7(9,10)11/h1-3H
InChI key:InChIKey=QNUJXCYQMARCJV-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C1=C(I)C=C(F)C=C1
Synonyms:- 4-Fluoro-2-iodo-1-(trifluoromethoxy)benzene
- Benzene, 4-fluoro-2-iodo-1-(trifluoromethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.