CymitQuimica logo

CAS 1263059-02-4

:

6-Methylpyrazolo[1,5-a]pyrimidine-3-carboxaldehyde

Description:
6-Methylpyrazolo[1,5-a]pyrimidine-3-carboxaldehyde is a heterocyclic organic compound characterized by its pyrazolo and pyrimidine ring structures, which contribute to its unique chemical properties. This compound features a methyl group at the 6-position of the pyrazolo ring and an aldehyde functional group at the 3-position of the pyrimidine moiety. The presence of these functional groups suggests potential reactivity, particularly in nucleophilic addition reactions typical of aldehydes. The compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features may influence its solubility, stability, and interaction with biological targets. Additionally, the compound's synthesis and characterization can involve various organic chemistry techniques, including spectroscopy and chromatography, to confirm its identity and purity. Overall, 6-Methylpyrazolo[1,5-a]pyrimidine-3-carboxaldehyde represents a valuable scaffold for further research in both synthetic and applied chemistry contexts.
Formula:C8H7N3O
InChI:InChI=1S/C8H7N3O/c1-6-2-9-8-7(5-12)3-10-11(8)4-6/h2-5H,1H3
InChI key:InChIKey=KYWSVSMGCCNXCT-UHFFFAOYSA-N
SMILES:C(=O)C1=C2N(N=C1)C=C(C)C=N2
Synonyms:
  • 6-Methylpyrazolo[1,5-a]pyrimidine-3-carboxaldehyde
  • Pyrazolo[1,5-a]pyrimidine-3-carboxaldehyde, 6-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.