
CAS 1263062-29-8
:Methyl 2-(2-bromophenyl)-5-pyrimidinecarboxylate
Description:
Methyl 2-(2-bromophenyl)-5-pyrimidinecarboxylate is an organic compound characterized by its pyrimidine ring structure, which is a six-membered heterocyclic compound containing nitrogen atoms. This substance features a bromophenyl group, indicating the presence of a bromine atom attached to a phenyl ring, which contributes to its reactivity and potential applications in medicinal chemistry. The methyl ester functional group enhances its solubility in organic solvents and may influence its biological activity. The compound is likely to exhibit moderate to high lipophilicity due to the aromatic bromophenyl moiety, which can affect its pharmacokinetic properties. Additionally, the presence of the pyrimidine ring suggests potential interactions with biological targets, making it of interest in drug development. Safety and handling precautions should be observed, as halogenated compounds can pose environmental and health risks. Overall, Methyl 2-(2-bromophenyl)-5-pyrimidinecarboxylate is a compound of interest in various chemical and pharmaceutical applications, warranting further investigation into its properties and potential uses.
Formula:C12H9BrN2O2
InChI:InChI=1S/C12H9BrN2O2/c1-17-12(16)8-6-14-11(15-7-8)9-4-2-3-5-10(9)13/h2-7H,1H3
InChI key:InChIKey=RSBFWQDQPRHBNN-UHFFFAOYSA-N
SMILES:BrC1=C(C=CC=C1)C=2N=CC(C(OC)=O)=CN2
Synonyms:- Methyl 2-(2-bromophenyl)-5-pyrimidinecarboxylate
- 5-Pyrimidinecarboxylic acid, 2-(2-bromophenyl)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.