
CAS 1263078-11-0
:(αR,γR)-γ-Amino-α-ethylbenzenepropanol
Description:
(αR,γR)-γ-Amino-α-ethylbenzenepropanol, identified by its CAS number 1263078-11-0, is a chiral compound characterized by its specific stereochemistry, which plays a crucial role in its biological activity and interactions. This substance features an amino group and an alcohol functional group, contributing to its potential as a pharmacological agent. The presence of the ethylbenzene moiety suggests that it may exhibit hydrophobic characteristics, influencing its solubility and permeability in biological systems. The compound's stereochemistry, denoted by the (αR,γR) configuration, indicates that it has two chiral centers, which can significantly affect its pharmacodynamics and pharmacokinetics. Such compounds are often investigated for their potential therapeutic applications, particularly in the fields of neurology and psychiatry, where amino alcohols can act as neurotransmitter modulators. Overall, the unique structural features of (αR,γR)-γ-Amino-α-ethylbenzenepropanol make it a subject of interest in medicinal chemistry and drug development.
Formula:C11H17NO
InChI:InChI=1S/C11H17NO/c1-2-10(13)8-11(12)9-6-4-3-5-7-9/h3-7,10-11,13H,2,8,12H2,1H3/t10-,11-/m1/s1
InChI key:InChIKey=DNGRLALONHXQSX-GHMZBOCLSA-N
SMILES:[C@H](C[C@@H](CC)O)(N)C1=CC=CC=C1
Synonyms:- (αR,γR)-γ-Amino-α-ethylbenzenepropanol
- Benzenepropanol, γ-amino-α-ethyl-, (αR,γR)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.