CAS 1263078-30-3

Phenylmethyl (5S)-5-(hydroxymethyl)-2,2-dimethyl-4-morpholinecarboxylate

Description:

Phenylmethyl (5S)-5-(hydroxymethyl)-2,2-dimethyl-4-morpholinecarboxylate, identified by its CAS number 1263078-30-3, is a chemical compound that belongs to the class of morpholine derivatives. This substance features a morpholine ring, which is a six-membered heterocyclic structure containing one nitrogen atom and five carbon atoms. The compound is characterized by the presence of a hydroxymethyl group and a phenylmethyl moiety, contributing to its potential biological activity and solubility properties. It is typically a white to off-white solid at room temperature and may exhibit moderate stability under standard conditions. The presence of functional groups such as hydroxymethyl and carboxylate suggests that it may participate in various chemical reactions, including esterification and nucleophilic substitutions. Its specific applications and biological activities would depend on its interaction with biological systems, making it of interest in medicinal chemistry and drug development. As with many chemical substances, safety data and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₅H₂₁NO₄

InChI: InChI=1S/C15H21NO4/c1-15(2)11-16(13(8-17)10-20-15)14(18)19-9-12-6-4-3-5-7-12/h3-7,13,17H,8-11H2,1-2H3/t13-/m0/s1

InChI key: InChIKey=CHFKEFGYSYDIPT-ZDUSSCGKSA-N

SMILES: C(OCC1=CC=CC=C1)(=O)N2[C@@H](CO)COC(C)(C)C2

Synonyms:

• 4-Morpholinecarboxylic acid, 5-(hydroxymethyl)-2,2-dimethyl-, phenylmethyl ester, (5S)-
• Phenylmethyl (5S)-5-(hydroxymethyl)-2,2-dimethyl-4-morpholinecarboxylate