CAS 1263094-49-0

2-Pyridinemethanamine, 5-bromo-α-phenyl-, hydrochloride (1:1), (αS)-

Description:

2-Pyridinemethanamine, 5-bromo-α-phenyl-, hydrochloride (1:1), (αS)- is a chemical compound characterized by its structural features, which include a pyridine ring and an amine functional group. The presence of the bromine atom at the 5-position of the pyridine ring contributes to its reactivity and potential applications in organic synthesis. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various chemical reactions and biological applications. This compound may exhibit specific stereochemistry, indicated by the (αS) designation, which suggests a particular spatial arrangement of atoms that can influence its biological activity and interaction with other molecules. Its CAS number, 1263094-49-0, allows for precise identification and retrieval of information regarding its properties, safety data, and potential uses in research or pharmaceutical contexts. Overall, this compound is of interest in medicinal chemistry and may serve as a precursor or intermediate in the synthesis of more complex molecules.

Formula: C₁₂H₁₁BrN₂·ClH

InChI: InChI=1S/C12H11BrN2.ClH/c13-10-6-7-11(15-8-10)12(14)9-4-2-1-3-5-9;/h1-8,12H,14H2;1H/t12-;/m0./s1

InChI key: InChIKey=ZDNNKDNCXMJCNZ-YDALLXLXSA-N

SMILES: [C@@H](N)(C1=CC=C(Br)C=N1)C2=CC=CC=C2.Cl

Synonyms:

• 2-Pyridinemethanamine, 5-bromo-α-phenyl-, hydrochloride (1:1), (αS)-